C16H23Br2NO — CID 154338312
2,4-dibromo-6-[[cycloheptyl(ethyl)amino]methyl]phenol (PubChem CID 154338312) has the molecular formula C16H23Br2NO and a molecular weight of 405.17 g/mol. Its IUPAC name is 2,4-dibromo-6-[[cycloheptyl(ethyl)amino]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[[cycloheptyl(ethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 154338312 |
| Molecular Formula | C16H23Br2NO |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2,4-dibromo-6-[[cycloheptyl(ethyl)amino]methyl]phenol |
| SMILES | CCN(Cc1cc(Br)cc(Br)c1O)C1CCCCCC1 |
| InChI | InChI=1S/C16H23Br2NO/c1-2-19(14-7-5-3-4-6-8-14)11-12-9-13(17)10-15(18)16(12)20/h9-10,14,20H,2-8,11H2,1H3 |
| InChIKey | OYDLRMJBEHOTQX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|