C14H20Br2ClNO — CID 71365544
2,4-dibromo-6-[(cyclohexylmethylamino)methyl]phenol;hydrochloride (PubChem CID 71365544) has the molecular formula C14H20Br2ClNO and a molecular weight of 413.58 g/mol. Its IUPAC name is 2,4-dibromo-6-[(cyclohexylmethylamino)methyl]phenol;hydrochloride.
| Compound Name | 2,4-dibromo-6-[(cyclohexylmethylamino)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 71365544 |
| Molecular Formula | C14H20Br2ClNO |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | 2,4-dibromo-6-[(cyclohexylmethylamino)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1c(Br)cc(Br)cc1CNCC1CCCCC1 |
| InChI | InChI=1S/C14H19Br2NO.ClH/c15-12-6-11(14(18)13(16)7-12)9-17-8-10-4-2-1-3-5-10;/h6-7,10,17-18H,1-5,8-9H2;1H |
| InChIKey | HVQIXJCPOMXWPA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|