C10H13Br2NOS — CID 115904465
2,4-dibromo-6-[(2-methylsulfanylethylamino)methyl]phenol (PubChem CID 115904465) has the molecular formula C10H13Br2NOS and a molecular weight of 355.10 g/mol. Its IUPAC name is 2,4-dibromo-6-[(2-methylsulfanylethylamino)methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(2-methylsulfanylethylamino)methyl]phenol |
|---|---|
| PubChem CID | 115904465 |
| Molecular Formula | C10H13Br2NOS |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 352.91 |
| IUPAC Name | 2,4-dibromo-6-[(2-methylsulfanylethylamino)methyl]phenol |
| SMILES | CSCCNCc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C10H13Br2NOS/c1-15-3-2-13-6-7-4-8(11)5-9(12)10(7)14/h4-5,13-14H,2-3,6H2,1H3 |
| InChIKey | HKIASUBMXBIZLV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|