About 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide
3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide (PubChem CID 104586806) has the molecular formula C10H12Br2N2O2
and a molecular weight of 352.03 g/mol. Its IUPAC name is 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide.
Molecular Properties
| Compound Name | 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide |
| PubChem CID | 104586806 |
| Molecular Formula | C10H12Br2N2O2 |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide |
| SMILES | NC(=O)CCNCc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C10H12Br2N2O2/c11-7-3-6(10(16)8(12)4-7)5-14-2-1-9(13)15/h3-4,14,16H,1-2,5H2,(H2,13,15) |
| InChIKey | PCCDKDASZWGDSB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide?
The IUPAC name of 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide (CID 104586806) is 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide.
What is the SMILES notation for 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide?
The canonical SMILES for 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide is NC(=O)CCNCc1cc(Br)cc(Br)c1O.
What is the InChIKey of 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide?
The InChIKey is PCCDKDASZWGDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Br2N2O2/c11-7-3-6(10(16)8(12)4-7)5-14-2-1-9(13)15/h3-4,14,16H,1-2,5H2,(H2,13,15).
What are the key properties of 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide?
3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide has a molecular weight of 352.03 g/mol, XLogP of 1.88, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dibromo-2-hydroxyphenyl)methylamino]propanamide is sourced from PubChem (CID 104586806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).