C12H18N2O2 — CID 43423932
3-[(2-methoxy-5-methylphenyl)methylamino]propanamide (PubChem CID 43423932) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-[(2-methoxy-5-methylphenyl)methylamino]propanamide.
| Compound Name | 3-[(2-methoxy-5-methylphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 43423932 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-[(2-methoxy-5-methylphenyl)methylamino]propanamide |
| SMILES | COc1ccc(C)cc1CNCCC(N)=O |
| InChI | InChI=1S/C12H18N2O2/c1-9-3-4-11(16-2)10(7-9)8-14-6-5-12(13)15/h3-4,7,14H,5-6,8H2,1-2H3,(H2,13,15) |
| InChIKey | BQDHDUYPLXOZIH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|