C8H11BrN2O2 — CID 103931804
3-[(3-bromofuran-2-yl)methylamino]propanamide (PubChem CID 103931804) has the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. Its IUPAC name is 3-[(3-bromofuran-2-yl)methylamino]propanamide.
| Compound Name | 3-[(3-bromofuran-2-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 103931804 |
| Molecular Formula | C8H11BrN2O2 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 3-[(3-bromofuran-2-yl)methylamino]propanamide |
| SMILES | NC(=O)CCNCc1occc1Br |
| InChI | InChI=1S/C8H11BrN2O2/c9-6-2-4-13-7(6)5-11-3-1-8(10)12/h2,4,11H,1,3,5H2,(H2,10,12) |
| InChIKey | RBUNFRKOHJFSLS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|