C13H23BrN2O — CID 103675162
N-[(3-bromofuran-2-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 103675162) has the molecular formula C13H23BrN2O and a molecular weight of 303.24 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[(3-bromofuran-2-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103675162 |
| Molecular Formula | C13H23BrN2O |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-[(3-bromofuran-2-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNCc1occc1Br)C(C)C |
| InChI | InChI=1S/C13H23BrN2O/c1-10(2)16(11(3)4)7-6-15-9-13-12(14)5-8-17-13/h5,8,10-11,15H,6-7,9H2,1-4H3 |
| InChIKey | WJUVEJIOKXNHSE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|