C8H10BrNO3 — CID 106885107
3-[(3-bromofuran-2-yl)methylamino]propanoic acid (PubChem CID 106885107) has the molecular formula C8H10BrNO3 and a molecular weight of 248.08 g/mol. Its IUPAC name is 3-[(3-bromofuran-2-yl)methylamino]propanoic acid.
| Compound Name | 3-[(3-bromofuran-2-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 106885107 |
| Molecular Formula | C8H10BrNO3 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 3-[(3-bromofuran-2-yl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1occc1Br |
| InChI | InChI=1S/C8H10BrNO3/c9-6-2-4-13-7(6)5-10-3-1-8(11)12/h2,4,10H,1,3,5H2,(H,11,12) |
| InChIKey | IDRJECFXZLGXMR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|