C10H16BrNO3 — CID 106885364
N-[(3-bromofuran-2-yl)methyl]-1,1-dimethoxypropan-2-amine (PubChem CID 106885364) has the molecular formula C10H16BrNO3 and a molecular weight of 278.15 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)methyl]-1,1-dimethoxypropan-2-amine.
| Compound Name | N-[(3-bromofuran-2-yl)methyl]-1,1-dimethoxypropan-2-amine |
|---|---|
| PubChem CID | 106885364 |
| Molecular Formula | C10H16BrNO3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | N-[(3-bromofuran-2-yl)methyl]-1,1-dimethoxypropan-2-amine |
| SMILES | COC(OC)C(C)NCc1occc1Br |
| InChI | InChI=1S/C10H16BrNO3/c1-7(10(13-2)14-3)12-6-9-8(11)4-5-15-9/h4-5,7,10,12H,6H2,1-3H3 |
| InChIKey | RJWSUZWIJBQIQZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|