C11H16BrNO3 — CID 103275052
methyl 2-[(3-bromofuran-2-yl)methylamino]-3-methylbutanoate (PubChem CID 103275052) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is methyl 2-[(3-bromofuran-2-yl)methylamino]-3-methylbutanoate.
| Compound Name | methyl 2-[(3-bromofuran-2-yl)methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 103275052 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | methyl 2-[(3-bromofuran-2-yl)methylamino]-3-methylbutanoate |
| SMILES | COC(=O)C(NCc1occc1Br)C(C)C |
| InChI | InChI=1S/C11H16BrNO3/c1-7(2)10(11(14)15-3)13-6-9-8(12)4-5-16-9/h4-5,7,10,13H,6H2,1-3H3 |
| InChIKey | MLLKZNJOXVDTAY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |