C11H16INO3 — CID 43776105
methyl (2S)-2-[(5-iodofuran-2-yl)methylamino]-3-methylbutanoate (PubChem CID 43776105) has the molecular formula C11H16INO3 and a molecular weight of 337.16 g/mol. Its IUPAC name is methyl (2S)-2-[(5-iodofuran-2-yl)methylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(5-iodofuran-2-yl)methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 43776105 |
| Molecular Formula | C11H16INO3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | methyl (2S)-2-[(5-iodofuran-2-yl)methylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NCc1ccc(I)o1)C(C)C |
| InChI | InChI=1S/C11H16INO3/c1-7(2)10(11(14)15-3)13-6-8-4-5-9(12)16-8/h4-5,7,10,13H,6H2,1-3H3/t10-/m0/s1 |
| InChIKey | OLCCFHMEQMMULO-JTQLQIEISA-N |
| XLogP | 2.17 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|