C9H14BrNO3 — CID 79492649
1-(3-bromofuran-2-yl)-2,2-dimethoxy-N-methylethanamine (PubChem CID 79492649) has the molecular formula C9H14BrNO3 and a molecular weight of 264.12 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2,2-dimethoxy-N-methylethanamine.
| Compound Name | 1-(3-bromofuran-2-yl)-2,2-dimethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 79492649 |
| Molecular Formula | C9H14BrNO3 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2,2-dimethoxy-N-methylethanamine |
| SMILES | CNC(c1occc1Br)C(OC)OC |
| InChI | InChI=1S/C9H14BrNO3/c1-11-7(9(12-2)13-3)8-6(10)4-5-14-8/h4-5,7,9,11H,1-3H3 |
| InChIKey | CGNREALYANIAAU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|