C11H18BrNO2 — CID 116719920
1-(3-bromofuran-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine (PubChem CID 116719920) has the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine.
| Compound Name | 1-(3-bromofuran-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 116719920 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine |
| SMILES | CNC(c1occc1Br)C(OC)C(C)C |
| InChI | InChI=1S/C11H18BrNO2/c1-7(2)10(14-4)9(13-3)11-8(12)5-6-15-11/h5-7,9-10,13H,1-4H3 |
| InChIKey | RDKVAOUHOPRIKI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |