C10H14BrNO — CID 64987211
1-(3-bromofuran-2-yl)-1-cyclobutyl-N-methylmethanamine (PubChem CID 64987211) has the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-1-cyclobutyl-N-methylmethanamine.
| Compound Name | 1-(3-bromofuran-2-yl)-1-cyclobutyl-N-methylmethanamine |
|---|---|
| PubChem CID | 64987211 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-1-cyclobutyl-N-methylmethanamine |
| SMILES | CNC(c1occc1Br)C1CCC1 |
| InChI | InChI=1S/C10H14BrNO/c1-12-9(7-3-2-4-7)10-8(11)5-6-13-10/h5-7,9,12H,2-4H2,1H3 |
| InChIKey | LDEPTRJRWCPHPT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |