C11H16BrNO2 — CID 115861419
1-(3-bromofuran-2-yl)-N-methyl-1-(3-methyloxolan-2-yl)methanamine (PubChem CID 115861419) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-N-methyl-1-(3-methyloxolan-2-yl)methanamine.
| Compound Name | 1-(3-bromofuran-2-yl)-N-methyl-1-(3-methyloxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 115861419 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-N-methyl-1-(3-methyloxolan-2-yl)methanamine |
| SMILES | CNC(c1occc1Br)C1OCCC1C |
| InChI | InChI=1S/C11H16BrNO2/c1-7-3-5-14-10(7)9(13-2)11-8(12)4-6-15-11/h4,6-7,9-10,13H,3,5H2,1-2H3 |
| InChIKey | SJFKWDUKASSOEX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |