C11H16BrNO2 — CID 63943419
1-(3-bromofuran-2-yl)-N-methyl-2-(oxolan-2-yl)ethanamine (PubChem CID 63943419) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-N-methyl-2-(oxolan-2-yl)ethanamine.
| Compound Name | 1-(3-bromofuran-2-yl)-N-methyl-2-(oxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 63943419 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-N-methyl-2-(oxolan-2-yl)ethanamine |
| SMILES | CNC(CC1CCCO1)c1occc1Br |
| InChI | InChI=1S/C11H16BrNO2/c1-13-10(7-8-3-2-5-14-8)11-9(12)4-6-15-11/h4,6,8,10,13H,2-3,5,7H2,1H3 |
| InChIKey | OLPKVLLTQVFTTB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |