C12H18BrNO2 — CID 115861332
1-(3-bromofuran-2-yl)-N-methyl-3-(oxolan-2-yl)propan-1-amine (PubChem CID 115861332) has the molecular formula C12H18BrNO2 and a molecular weight of 288.18 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-N-methyl-3-(oxolan-2-yl)propan-1-amine.
| Compound Name | 1-(3-bromofuran-2-yl)-N-methyl-3-(oxolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 115861332 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-N-methyl-3-(oxolan-2-yl)propan-1-amine |
| SMILES | CNC(CCC1CCCO1)c1occc1Br |
| InChI | InChI=1S/C12H18BrNO2/c1-14-11(12-10(13)6-8-16-12)5-4-9-3-2-7-15-9/h6,8-9,11,14H,2-5,7H2,1H3 |
| InChIKey | ZFDWWJCJUOOORR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |