C11H18BrNO — CID 115861224
1-(3-bromofuran-2-yl)-N,2-dimethylpentan-1-amine (PubChem CID 115861224) has the molecular formula C11H18BrNO and a molecular weight of 260.17 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-N,2-dimethylpentan-1-amine.
| Compound Name | 1-(3-bromofuran-2-yl)-N,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 115861224 |
| Molecular Formula | C11H18BrNO |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-N,2-dimethylpentan-1-amine |
| SMILES | CCCC(C)C(NC)c1occc1Br |
| InChI | InChI=1S/C11H18BrNO/c1-4-5-8(2)10(13-3)11-9(12)6-7-14-11/h6-8,10,13H,4-5H2,1-3H3 |
| InChIKey | SZOIKNHJZSKILP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |