C9H13BrO3 — CID 103454948
1-(3-bromofuran-2-yl)pentane-1,2-diol (PubChem CID 103454948) has the molecular formula C9H13BrO3 and a molecular weight of 249.10 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)pentane-1,2-diol.
| Compound Name | 1-(3-bromofuran-2-yl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103454948 |
| Molecular Formula | C9H13BrO3 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 1-(3-bromofuran-2-yl)pentane-1,2-diol |
| SMILES | CCCC(O)C(O)c1occc1Br |
| InChI | InChI=1S/C9H13BrO3/c1-2-3-7(11)8(12)9-6(10)4-5-13-9/h4-5,7-8,11-12H,2-3H2,1H3 |
| InChIKey | DSUBTIXTYQAHPK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |