C7H8BrNO4 — CID 171869605
3-(3-bromofuran-2-yl)-2,3-dihydroxypropanamide (PubChem CID 171869605) has the molecular formula C7H8BrNO4 and a molecular weight of 250.05 g/mol. Its IUPAC name is 3-(3-bromofuran-2-yl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(3-bromofuran-2-yl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869605 |
| Molecular Formula | C7H8BrNO4 |
| Molecular Weight | 250.05 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 3-(3-bromofuran-2-yl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1occc1Br |
| InChI | InChI=1S/C7H8BrNO4/c8-3-1-2-13-6(3)4(10)5(11)7(9)12/h1-2,4-5,10-11H,(H2,9,12) |
| InChIKey | BMEWMXPTVSDSQW-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.05 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |