C12H17Br2NO3 — CID 107740818
2,6-dibromo-4-[(1,1-dimethoxypropan-2-ylamino)methyl]phenol (PubChem CID 107740818) has the molecular formula C12H17Br2NO3 and a molecular weight of 383.08 g/mol. Its IUPAC name is 2,6-dibromo-4-[(1,1-dimethoxypropan-2-ylamino)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(1,1-dimethoxypropan-2-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 107740818 |
| Molecular Formula | C12H17Br2NO3 |
| Molecular Weight | 383.08 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 2,6-dibromo-4-[(1,1-dimethoxypropan-2-ylamino)methyl]phenol |
| SMILES | COC(OC)C(C)NCc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C12H17Br2NO3/c1-7(12(17-2)18-3)15-6-8-4-9(13)11(16)10(14)5-8/h4-5,7,12,15-16H,6H2,1-3H3 |
| InChIKey | GQNGTLAOLTVDCN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.08 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|