C13H22Br2N2O — CID 62085345
N-[(4,5-dibromofuran-2-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 62085345) has the molecular formula C13H22Br2N2O and a molecular weight of 382.14 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62085345 |
| Molecular Formula | C13H22Br2N2O |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNCc1cc(Br)c(Br)o1)C(C)C |
| InChI | InChI=1S/C13H22Br2N2O/c1-9(2)17(10(3)4)6-5-16-8-11-7-12(14)13(15)18-11/h7,9-10,16H,5-6,8H2,1-4H3 |
| InChIKey | WZAAXEAEUYXGJB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|