C10H12Br2N4O — CID 55202670
N-[(4,5-dibromofuran-2-yl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 55202670) has the molecular formula C10H12Br2N4O and a molecular weight of 364.04 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 55202670 |
| Molecular Formula | C10H12Br2N4O |
| Molecular Weight | 364.04 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | Cn1cnnc1CCNCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C10H12Br2N4O/c1-16-6-14-15-9(16)2-3-13-5-7-4-8(11)10(12)17-7/h4,6,13H,2-3,5H2,1H3 |
| InChIKey | NXZRZVLODIGDMM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.04 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|