C14H19BrN4O2 — CID 63332405
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 63332405) has the molecular formula C14H19BrN4O2 and a molecular weight of 355.24 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 63332405 |
| Molecular Formula | C14H19BrN4O2 |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | COc1cc(Br)c(CNCCc2nncn2C)cc1OC |
| InChI | InChI=1S/C14H19BrN4O2/c1-19-9-17-18-14(19)4-5-16-8-10-6-12(20-2)13(21-3)7-11(10)15/h6-7,9,16H,4-5,8H2,1-3H3 |
| InChIKey | AKYQRLFSLQSPEA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|