C13H11Br2F2NO — CID 62604246
N-[(4,5-dibromofuran-2-yl)methyl]-2-(3,5-difluorophenyl)ethanamine (PubChem CID 62604246) has the molecular formula C13H11Br2F2NO and a molecular weight of 395.04 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-2-(3,5-difluorophenyl)ethanamine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(3,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 62604246 |
| Molecular Formula | C13H11Br2F2NO |
| Molecular Weight | 395.04 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(3,5-difluorophenyl)ethanamine |
| SMILES | Fc1cc(F)cc(CCNCc2cc(Br)c(Br)o2)c1 |
| InChI | InChI=1S/C13H11Br2F2NO/c14-12-6-11(19-13(12)15)7-18-2-1-8-3-9(16)5-10(17)4-8/h3-6,18H,1-2,7H2 |
| InChIKey | VIIFBYRJXJALEI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.04 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|