C10H11Br2N3O — CID 65232025
N-[(4,5-dibromofuran-2-yl)methyl]-2-(1H-imidazol-5-yl)ethanamine (PubChem CID 65232025) has the molecular formula C10H11Br2N3O and a molecular weight of 349.03 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-2-(1H-imidazol-5-yl)ethanamine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 65232025 |
| Molecular Formula | C10H11Br2N3O |
| Molecular Weight | 349.03 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(1H-imidazol-5-yl)ethanamine |
| SMILES | Brc1cc(CNCCc2cnc[nH]2)oc1Br |
| InChI | InChI=1S/C10H11Br2N3O/c11-9-3-8(16-10(9)12)5-13-2-1-7-4-14-6-15-7/h3-4,6,13H,1-2,5H2,(H,14,15) |
| InChIKey | FINFURVXHIHGID-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.03 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|