C9H11Br2NO3 — CID 62083449
4-[(4,5-dibromofuran-2-yl)methylamino]butanoic acid (PubChem CID 62083449) has the molecular formula C9H11Br2NO3 and a molecular weight of 341.00 g/mol. Its IUPAC name is 4-[(4,5-dibromofuran-2-yl)methylamino]butanoic acid.
| Compound Name | 4-[(4,5-dibromofuran-2-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 62083449 |
| Molecular Formula | C9H11Br2NO3 |
| Molecular Weight | 341.00 g/mol |
| Exact Mass | 338.91 |
| IUPAC Name | 4-[(4,5-dibromofuran-2-yl)methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C9H11Br2NO3/c10-7-4-6(15-9(7)11)5-12-3-1-2-8(13)14/h4,12H,1-3,5H2,(H,13,14) |
| InChIKey | XVKZJMHBYWEGPD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.00 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|