C13H21Br2N3O — CID 55032641
N-[(4,5-dibromofuran-2-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 55032641) has the molecular formula C13H21Br2N3O and a molecular weight of 395.14 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 55032641 |
| Molecular Formula | C13H21Br2N3O |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CN1CCN(CCCNCc2cc(Br)c(Br)o2)CC1 |
| InChI | InChI=1S/C13H21Br2N3O/c1-17-5-7-18(8-6-17)4-2-3-16-10-11-9-12(14)13(15)19-11/h9,16H,2-8,10H2,1H3 |
| InChIKey | FRXFYBMFBIENFZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|