C18H28BrN3O2 — CID 119138412
N-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 119138412) has the molecular formula C18H28BrN3O2 and a molecular weight of 398.35 g/mol. Its IUPAC name is N-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 119138412 |
| Molecular Formula | C18H28BrN3O2 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CN1CCN(CCCNCc2cc(Br)c3c(c2)OCCCO3)CC1 |
| InChI | InChI=1S/C18H28BrN3O2/c1-21-6-8-22(9-7-21)5-2-4-20-14-15-12-16(19)18-17(13-15)23-10-3-11-24-18/h12-13,20H,2-11,14H2,1H3 |
| InChIKey | VBRDMEMQXNMPCI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|