C16H22BrNO4 — CID 122126923
4-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122126923) has the molecular formula C16H22BrNO4 and a molecular weight of 372.26 g/mol. Its IUPAC name is 4-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122126923 |
| Molecular Formula | C16H22BrNO4 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1cc(Br)c2c(c1)OCCCO2)C(=O)O |
| InChI | InChI=1S/C16H22BrNO4/c1-16(2,15(19)20)4-5-18-10-11-8-12(17)14-13(9-11)21-6-3-7-22-14/h8-9,18H,3-7,10H2,1-2H3,(H,19,20) |
| InChIKey | CZHIIVUMDODRLC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|