C14H22BrN3 — CID 89199659
2-bromo-6-[[cyclohexyl(methyl)amino]methyl]benzene-1,4-diamine (PubChem CID 89199659) has the molecular formula C14H22BrN3 and a molecular weight of 312.25 g/mol. Its IUPAC name is 2-bromo-6-[[cyclohexyl(methyl)amino]methyl]benzene-1,4-diamine.
| Compound Name | 2-bromo-6-[[cyclohexyl(methyl)amino]methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 89199659 |
| Molecular Formula | C14H22BrN3 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-bromo-6-[[cyclohexyl(methyl)amino]methyl]benzene-1,4-diamine |
| SMILES | CN(Cc1cc(N)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C14H22BrN3/c1-18(12-5-3-2-4-6-12)9-10-7-11(16)8-13(15)14(10)17/h7-8,12H,2-6,9,16-17H2,1H3 |
| InChIKey | GDNUPVFDZLMGMU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|