C39H48BrClN4O6 — CID 20516231
2-(2-acetyloxyethylamino)ethyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone (PubChem CID 20516231) has the molecular formula C39H48BrClN4O6 and a molecular weight of 784.19 g/mol. Its IUPAC name is 2-(2-acetyloxyethylamino)ethyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone.
| Compound Name | 2-(2-acetyloxyethylamino)ethyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone |
|---|---|
| PubChem CID | 20516231 |
| Molecular Formula | C39H48BrClN4O6 |
| Molecular Weight | 784.19 g/mol |
| Exact Mass | 782.24 |
| IUPAC Name | 2-(2-acetyloxyethylamino)ethyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone |
| SMILES | CCN(Cc1cc(C(=O)OCCNCCOC(C)=O)cc(Br)c1N)C1CCCCC1.COc1ccc2c(c1)cc(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H34BrN3O4.C17H14ClNO2/c1-3-26(19-7-5-4-6-8-19)15-18-13-17(14-20(23)21(18)24)22(28)30-12-10-25-9-11-29-16(2)27;1-11-9-13-10-15(21-2)7-8-16(13)19(11)17(20)12-3-5-14(18)6-4-12/h13-14,19,25H,3-12,15,24H2,1-2H3;3-10H,1-2H3 |
| InChIKey | RKGCGYSBWOCTNJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.19 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|