C38H44BrCl2N3O6 — CID 70548820
(1-acetyloxy-3-chloropropan-2-yl) 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone (PubChem CID 70548820) has the molecular formula C38H44BrCl2N3O6 and a molecular weight of 789.60 g/mol. Its IUPAC name is (1-acetyloxy-3-chloropropan-2-yl) 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone.
| Compound Name | (1-acetyloxy-3-chloropropan-2-yl) 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone |
|---|---|
| PubChem CID | 70548820 |
| Molecular Formula | C38H44BrCl2N3O6 |
| Molecular Weight | 789.60 g/mol |
| Exact Mass | 787.18 |
| IUPAC Name | (1-acetyloxy-3-chloropropan-2-yl) 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone |
| SMILES | CCN(Cc1cc(C(=O)OC(CCl)COC(C)=O)cc(Br)c1N)C1CCCCC1.COc1ccc2c(c1)cc(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H30BrClN2O4.C17H14ClNO2/c1-3-25(17-7-5-4-6-8-17)12-16-9-15(10-19(22)20(16)24)21(27)29-18(11-23)13-28-14(2)26;1-11-9-13-10-15(21-2)7-8-16(13)19(11)17(20)12-3-5-14(18)6-4-12/h9-10,17-18H,3-8,11-13,24H2,1-2H3;3-10H,1-2H3 |
| InChIKey | OFHBQDJNFDJICL-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.60 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|