C36H41BrClN3O6 — CID 20516020
5-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxypentyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate (PubChem CID 20516020) has the molecular formula C36H41BrClN3O6 and a molecular weight of 727.10 g/mol. Its IUPAC name is 5-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxypentyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate.
| Compound Name | 5-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxypentyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
|---|---|
| PubChem CID | 20516020 |
| Molecular Formula | C36H41BrClN3O6 |
| Molecular Weight | 727.10 g/mol |
| Exact Mass | 725.19 |
| IUPAC Name | 5-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxypentyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
| SMILES | CCN(CC)Cc1cc(C(=O)OCCCCCOC(=O)Cc2c(C)n(C(=O)c3ccc(Cl)cc3)c3ccc(OC)cc23)cc(Br)c1N |
| InChI | InChI=1S/C36H41BrClN3O6/c1-5-40(6-2)22-26-18-25(19-31(37)34(26)39)36(44)47-17-9-7-8-16-46-33(42)21-29-23(3)41(32-15-14-28(45-4)20-30(29)32)35(43)24-10-12-27(38)13-11-24/h10-15,18-20H,5-9,16-17,21-22,39H2,1-4H3 |
| InChIKey | YNDBCGNOILUXAA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.10 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|