C36H39BrClN3O6 — CID 54109281
2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyethyl 4-amino-3-bromo-5-[(cyclohexylmethylamino)methyl]benzoate (PubChem CID 54109281) has the molecular formula C36H39BrClN3O6 and a molecular weight of 725.08 g/mol. Its IUPAC name is 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyethyl 4-amino-3-bromo-5-[(cyclohexylmethylamino)methyl]benzoate.
| Compound Name | 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyethyl 4-amino-3-bromo-5-[(cyclohexylmethylamino)methyl]benzoate |
|---|---|
| PubChem CID | 54109281 |
| Molecular Formula | C36H39BrClN3O6 |
| Molecular Weight | 725.08 g/mol |
| Exact Mass | 723.17 |
| IUPAC Name | 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyethyl 4-amino-3-bromo-5-[(cyclohexylmethylamino)methyl]benzoate |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCCOC(=O)c1cc(Br)c(N)c(CNCC3CCCCC3)c1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H39BrClN3O6/c1-22-29(30-18-28(45-2)12-13-32(30)41(22)35(43)24-8-10-27(38)11-9-24)19-33(42)46-14-15-47-36(44)25-16-26(34(39)31(37)17-25)21-40-20-23-6-4-3-5-7-23/h8-13,16-18,23,40H,3-7,14-15,19-21,39H2,1-2H3 |
| InChIKey | NFYAAKLMVBSSBD-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.08 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|