C30H30ClNO6 — CID 69135301
4-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]-2-(cyclohexylmethyl)-3-hydroxy-2H-furan-5-one (PubChem CID 69135301) has the molecular formula C30H30ClNO6 and a molecular weight of 536.02 g/mol. Its IUPAC name is 4-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]-2-(cyclohexylmethyl)-3-hydroxy-2H-furan-5-one.
| Compound Name | 4-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]-2-(cyclohexylmethyl)-3-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 69135301 |
| Molecular Formula | C30H30ClNO6 |
| Molecular Weight | 536.02 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 4-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]-2-(cyclohexylmethyl)-3-hydroxy-2H-furan-5-one |
| SMILES | COc1ccc2c(c1)c(CC(=O)C1=C(O)C(CC3CCCCC3)OC1=O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H30ClNO6/c1-17-22(16-25(33)27-28(34)26(38-30(27)36)14-18-6-4-3-5-7-18)23-15-21(37-2)12-13-24(23)32(17)29(35)19-8-10-20(31)11-9-19/h8-13,15,18,26,34H,3-7,14,16H2,1-2H3 |
| InChIKey | FRRKQOSUGZNJBH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.02 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|