C32H35BrClN3O6 — CID 20516163
2-acetyloxyethyl 4-amino-3-bromo-5-[(propan-2-ylamino)methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone (PubChem CID 20516163) has the molecular formula C32H35BrClN3O6 and a molecular weight of 673.00 g/mol. Its IUPAC name is 2-acetyloxyethyl 4-amino-3-bromo-5-[(propan-2-ylamino)methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone.
| Compound Name | 2-acetyloxyethyl 4-amino-3-bromo-5-[(propan-2-ylamino)methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone |
|---|---|
| PubChem CID | 20516163 |
| Molecular Formula | C32H35BrClN3O6 |
| Molecular Weight | 673.00 g/mol |
| Exact Mass | 671.14 |
| IUPAC Name | 2-acetyloxyethyl 4-amino-3-bromo-5-[(propan-2-ylamino)methyl]benzoate;(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone |
| SMILES | CC(=O)OCCOC(=O)c1cc(Br)c(N)c(CNC(C)C)c1.COc1ccc2c(c1)cc(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO2.C15H21BrN2O4/c1-11-9-13-10-15(21-2)7-8-16(13)19(11)17(20)12-3-5-14(18)6-4-12;1-9(2)18-8-12-6-11(7-13(16)14(12)17)15(20)22-5-4-21-10(3)19/h3-10H,1-2H3;6-7,9,18H,4-5,8,17H2,1-3H3 |
| InChIKey | RUWJGBYKQUUYHW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.00 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|