C22H28Cl3NO2Sn — CID 16686790
[dibutyl(chloro)stannyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 16686790) has the molecular formula C22H28Cl3NO2Sn and a molecular weight of 563.54 g/mol. Its IUPAC name is [dibutyl(chloro)stannyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | [dibutyl(chloro)stannyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 16686790 |
| Molecular Formula | C22H28Cl3NO2Sn |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | [dibutyl(chloro)stannyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | CCCC[Sn](Cl)(CCCC)OC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2.2C4H9.ClH.Sn/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;2*1-3-4-2;;/h1-7,17H,8H2,(H,18,19);2*1,3-4H2,2H3;1H;/q;;;;+2/p-2 |
| InChIKey | RCZVEOWYARLITI-UHFFFAOYSA-L |
| XLogP | 8.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |