C21H19F4N3O2 — CID 23331693
2-(dimethylamino)ethyl 5-fluoro-2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate (PubChem CID 23331693) has the molecular formula C21H19F4N3O2 and a molecular weight of 421.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 5-fluoro-2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate.
| Compound Name | 2-(dimethylamino)ethyl 5-fluoro-2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 23331693 |
| Molecular Formula | C21H19F4N3O2 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 5-fluoro-2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate |
| SMILES | CN(C)CCOC(=O)c1cc(F)ccc1Nc1ccnc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C21H19F4N3O2/c1-28(2)10-11-30-20(29)15-12-13(22)6-7-17(15)27-18-8-9-26-19-14(18)4-3-5-16(19)21(23,24)25/h3-9,12H,10-11H2,1-2H3,(H,26,27) |
| InChIKey | XAABQOXNZOODQY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |