C18H15F3N2 — CID 43833157
N-(2,4-dimethylphenyl)-8-(trifluoromethyl)quinolin-4-amine (PubChem CID 43833157) has the molecular formula C18H15F3N2 and a molecular weight of 316.33 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-8-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-(2,4-dimethylphenyl)-8-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 43833157 |
| Molecular Formula | C18H15F3N2 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-(2,4-dimethylphenyl)-8-(trifluoromethyl)quinolin-4-amine |
| SMILES | Cc1ccc(Nc2ccnc3c(C(F)(F)F)cccc23)c(C)c1 |
| InChI | InChI=1S/C18H15F3N2/c1-11-6-7-15(12(2)10-11)23-16-8-9-22-17-13(16)4-3-5-14(17)18(19,20)21/h3-10H,1-2H3,(H,22,23) |
| InChIKey | JIFHIIQZGMGVAV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |