C18H13F3N2O — CID 43833315
1-[2-[[8-(trifluoromethyl)quinolin-4-yl]amino]phenyl]ethanone (PubChem CID 43833315) has the molecular formula C18H13F3N2O and a molecular weight of 330.31 g/mol. Its IUPAC name is 1-[2-[[8-(trifluoromethyl)quinolin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[2-[[8-(trifluoromethyl)quinolin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 43833315 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-[2-[[8-(trifluoromethyl)quinolin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1Nc1ccnc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C18H13F3N2O/c1-11(24)12-5-2-3-8-15(12)23-16-9-10-22-17-13(16)6-4-7-14(17)18(19,20)21/h2-10H,1H3,(H,22,23) |
| InChIKey | SRJJHBNCIHJQKU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |