C21H19F3N2O2 — CID 11315223
butyl 2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate (PubChem CID 11315223) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is butyl 2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate.
| Compound Name | butyl 2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 11315223 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | butyl 2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1Nc1ccnc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C21H19F3N2O2/c1-2-3-13-28-20(27)15-7-4-5-10-17(15)26-18-11-12-25-19-14(18)8-6-9-16(19)21(22,23)24/h4-12H,2-3,13H2,1H3,(H,25,26) |
| InChIKey | QBWSXHGEYUMEQF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|