About 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine
4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine (PubChem CID 83060646) has the molecular formula C17H17N3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine.
Molecular Properties
| Compound Name | 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine |
| PubChem CID | 83060646 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine |
| SMILES | Cc1ccc(C)c(Nc2ccnc3c(N)cccc23)c1 |
| InChI | InChI=1S/C17H17N3/c1-11-6-7-12(2)16(10-11)20-15-8-9-19-17-13(15)4-3-5-14(17)18/h3-10H,18H2,1-2H3,(H,19,20) |
| InChIKey | LJTMOFFDQOUKBD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine?
The IUPAC name of 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine (CID 83060646) is 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine.
What is the SMILES notation for 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine?
The canonical SMILES for 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine is Cc1ccc(C)c(Nc2ccnc3c(N)cccc23)c1.
What is the InChIKey of 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine?
The InChIKey is LJTMOFFDQOUKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3/c1-11-6-7-12(2)16(10-11)20-15-8-9-19-17-13(15)4-3-5-14(17)18/h3-10H,18H2,1-2H3,(H,19,20).
What are the key properties of 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine?
4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine has a molecular weight of 263.34 g/mol, XLogP of 4.18, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2,5-dimethylphenyl)quinoline-4,8-diamine is sourced from PubChem (CID 83060646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).