C26H33F3N4O — CID 10096462
2,6-bis(diethylaminomethyl)-4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenol (PubChem CID 10096462) has the molecular formula C26H33F3N4O and a molecular weight of 474.57 g/mol. Its IUPAC name is 2,6-bis(diethylaminomethyl)-4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenol.
| Compound Name | 2,6-bis(diethylaminomethyl)-4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 10096462 |
| Molecular Formula | C26H33F3N4O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2,6-bis(diethylaminomethyl)-4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenol |
| SMILES | CCN(CC)Cc1cc(Nc2ccnc3cc(C(F)(F)F)ccc23)cc(CN(CC)CC)c1O |
| InChI | InChI=1S/C26H33F3N4O/c1-5-32(6-2)16-18-13-21(14-19(25(18)34)17-33(7-3)8-4)31-23-11-12-30-24-15-20(26(27,28)29)9-10-22(23)24/h9-15,34H,5-8,16-17H2,1-4H3,(H,30,31) |
| InChIKey | SRZDIPUUBKHZQI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|