C17H13F3N2O — CID 44532338
2-methyl-5-[[6-(trifluoromethyl)quinolin-4-yl]amino]phenol (PubChem CID 44532338) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-methyl-5-[[6-(trifluoromethyl)quinolin-4-yl]amino]phenol.
| Compound Name | 2-methyl-5-[[6-(trifluoromethyl)quinolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 44532338 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-methyl-5-[[6-(trifluoromethyl)quinolin-4-yl]amino]phenol |
| SMILES | Cc1ccc(Nc2ccnc3ccc(C(F)(F)F)cc23)cc1O |
| InChI | InChI=1S/C17H13F3N2O/c1-10-2-4-12(9-16(10)23)22-15-6-7-21-14-5-3-11(8-13(14)15)17(18,19)20/h2-9,23H,1H3,(H,21,22) |
| InChIKey | YXUYOSYQTJFGTK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |