C13H10F4N2 — CID 113367381
2-fluoro-N-[2-methyl-5-(trifluoromethyl)phenyl]pyridin-4-amine (PubChem CID 113367381) has the molecular formula C13H10F4N2 and a molecular weight of 270.23 g/mol. Its IUPAC name is 2-fluoro-N-[2-methyl-5-(trifluoromethyl)phenyl]pyridin-4-amine.
| Compound Name | 2-fluoro-N-[2-methyl-5-(trifluoromethyl)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 113367381 |
| Molecular Formula | C13H10F4N2 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-fluoro-N-[2-methyl-5-(trifluoromethyl)phenyl]pyridin-4-amine |
| SMILES | Cc1ccc(C(F)(F)F)cc1Nc1ccnc(F)c1 |
| InChI | InChI=1S/C13H10F4N2/c1-8-2-3-9(13(15,16)17)6-11(8)19-10-4-5-18-12(14)7-10/h2-7H,1H3,(H,18,19) |
| InChIKey | XXLQLRXHZJDDKX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|