C21H18F4N2O3 — CID 162711430
(1R,2R,4S,5R,6S)-4-(2-fluoro-4-pyridinyl)-6-hydroxy-N-[2-methyl-5-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide (PubChem CID 162711430) has the molecular formula C21H18F4N2O3 and a molecular weight of 422.38 g/mol. Its IUPAC name is (1R,2R,4S,5R,6S)-4-(2-fluoro-4-pyridinyl)-6-hydroxy-N-[2-methyl-5-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide.
| Compound Name | (1R,2R,4S,5R,6S)-4-(2-fluoro-4-pyridinyl)-6-hydroxy-N-[2-methyl-5-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide |
|---|---|
| PubChem CID | 162711430 |
| Molecular Formula | C21H18F4N2O3 |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (1R,2R,4S,5R,6S)-4-(2-fluoro-4-pyridinyl)-6-hydroxy-N-[2-methyl-5-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide |
| SMILES | Cc1ccc(C(F)(F)F)cc1NC(=O)[C@]12C[C@@]1(c1ccnc(F)c1)[C@H]1O[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C21H18F4N2O3/c1-10-2-3-12(21(23,24)25)6-13(10)27-18(29)20-9-19(20,11-4-5-26-16(22)7-11)17-14(28)8-15(20)30-17/h2-7,14-15,17,28H,8-9H2,1H3,(H,27,29)/t14-,15+,17-,19+,20+/m0/s1 |
| InChIKey | YRAGBCLFIZRCMK-WLWDNUHBSA-N |
| XLogP | 3.35 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|