C21H16F6N2O3 — CID 162711470
(1R,2R,4S,5R,6S)-6-hydroxy-4-[3-(trifluoromethyl)phenyl]-N-[4-(trifluoromethyl)-2-pyridinyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide (PubChem CID 162711470) has the molecular formula C21H16F6N2O3 and a molecular weight of 458.36 g/mol. Its IUPAC name is (1R,2R,4S,5R,6S)-6-hydroxy-4-[3-(trifluoromethyl)phenyl]-N-[4-(trifluoromethyl)-2-pyridinyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide.
| Compound Name | (1R,2R,4S,5R,6S)-6-hydroxy-4-[3-(trifluoromethyl)phenyl]-N-[4-(trifluoromethyl)-2-pyridinyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide |
|---|---|
| PubChem CID | 162711470 |
| Molecular Formula | C21H16F6N2O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (1R,2R,4S,5R,6S)-6-hydroxy-4-[3-(trifluoromethyl)phenyl]-N-[4-(trifluoromethyl)-2-pyridinyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccn1)[C@]12C[C@@]1(c1cccc(C(F)(F)F)c1)[C@H]1O[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C21H16F6N2O3/c22-20(23,24)11-3-1-2-10(6-11)18-9-19(18,14-8-13(30)16(18)32-14)17(31)29-15-7-12(4-5-28-15)21(25,26)27/h1-7,13-14,16,30H,8-9H2,(H,28,29,31)/t13-,14+,16-,18+,19+/m0/s1 |
| InChIKey | WSVROCAIWRMNEI-WMRANVBESA-N |
| XLogP | 3.92 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |