C15H17F3N2O2 — CID 111637054
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[2-methyl-5-(trifluoromethyl)phenyl]urea (PubChem CID 111637054) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[2-methyl-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[2-methyl-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 111637054 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[2-methyl-5-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(C(F)(F)F)cc1NC(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C15H17F3N2O2/c1-9-2-4-11(15(16,17)18)7-13(9)20-14(22)19-12-5-3-10(6-12)8-21/h2-5,7,10,12,21H,6,8H2,1H3,(H2,19,20,22)/t10-,12+/m0/s1 |
| InChIKey | LZUGMPDQDKXZOH-CMPLNLGQSA-N |
| XLogP | 3.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|