C14H16BrFN2O2 — CID 99831977
1-(5-bromo-4-fluoro-2-methylphenyl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 99831977) has the molecular formula C14H16BrFN2O2 and a molecular weight of 343.20 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methylphenyl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-(5-bromo-4-fluoro-2-methylphenyl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 99831977 |
| Molecular Formula | C14H16BrFN2O2 |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methylphenyl)-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | Cc1cc(F)c(Br)cc1NC(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C14H16BrFN2O2/c1-8-4-12(16)11(15)6-13(8)18-14(20)17-10-3-2-9(5-10)7-19/h2-4,6,9-10,19H,5,7H2,1H3,(H2,17,18,20)/t9-,10+/m0/s1 |
| InChIKey | AWWHUEFWQAVNHZ-VHSXEESVSA-N |
| XLogP | 2.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|